C24H18N4O8 — CID 139075897
bis(2-carboxypyridine-3-carboxylate);4-pyridin-1-ium-4-ylpyridin-1-ium (PubChem CID 139075897) has the molecular formula C24H18N4O8 and a molecular weight of 490.43 g/mol. Its IUPAC name is bis(2-carboxypyridine-3-carboxylate);4-pyridin-1-ium-4-ylpyridin-1-ium.
| Compound Name | bis(2-carboxypyridine-3-carboxylate);4-pyridin-1-ium-4-ylpyridin-1-ium |
|---|---|
| PubChem CID | 139075897 |
| Molecular Formula | C24H18N4O8 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | bis(2-carboxypyridine-3-carboxylate);4-pyridin-1-ium-4-ylpyridin-1-ium |
| SMILES | O=C([O-])c1cccnc1C(=O)O.O=C([O-])c1cccnc1C(=O)O.c1cc(-c2cc[nH+]cc2)cc[nH+]1 |
| InChI | InChI=1S/C10H8N2.2C7H5NO4/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;2*9-6(10)4-2-1-3-8-5(4)7(11)12/h1-8H;2*1-3H,(H,9,10)(H,11,12) |
| InChIKey | OTZCPJQCBCAJRG-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 208.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |