C12H8N2O4 — CID 150193110
5-pyridin-3-ylpyridine-2,3-dicarboxylic acid (PubChem CID 150193110) has the molecular formula C12H8N2O4 and a molecular weight of 244.21 g/mol. Its IUPAC name is 5-pyridin-3-ylpyridine-2,3-dicarboxylic acid.
| Compound Name | 5-pyridin-3-ylpyridine-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150193110 |
| Molecular Formula | C12H8N2O4 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | 5-pyridin-3-ylpyridine-2,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(-c2cccnc2)cnc1C(=O)O |
| InChI | InChI=1S/C12H8N2O4/c15-11(16)9-4-8(6-14-10(9)12(17)18)7-2-1-3-13-5-7/h1-6H,(H,15,16)(H,17,18) |
| InChIKey | FNWBQQWIEKCPBR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |