C14H15ClO4S — CID 139076122
propyl 2-[5-chloro-3-[(S)-methylsulfinyl]-1-benzofuran-2-yl]acetate (PubChem CID 139076122) has the molecular formula C14H15ClO4S and a molecular weight of 314.79 g/mol. Its IUPAC name is propyl 2-[5-chloro-3-[(S)-methylsulfinyl]-1-benzofuran-2-yl]acetate.
| Compound Name | propyl 2-[5-chloro-3-[(S)-methylsulfinyl]-1-benzofuran-2-yl]acetate |
|---|---|
| PubChem CID | 139076122 |
| Molecular Formula | C14H15ClO4S |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | propyl 2-[5-chloro-3-[(S)-methylsulfinyl]-1-benzofuran-2-yl]acetate |
| SMILES | CCCOC(=O)Cc1oc2ccc(Cl)cc2c1[S@](C)=O |
| InChI | InChI=1S/C14H15ClO4S/c1-3-6-18-13(16)8-12-14(20(2)17)10-7-9(15)4-5-11(10)19-12/h4-5,7H,3,6,8H2,1-2H3/t20-/m0/s1 |
| InChIKey | LZSQIIRUYBSVPD-FQEVSTJZSA-N |
| XLogP | 3.32 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |