C26H22CuN2O4 — CID 139076745
copper 2-[(E)-C-methyl-N-[2-[(E)-1-(1-oxidonaphthalen-2-yl)ethylideneamino]oxyethoxy]carbonimidoyl]naphthalen-1-olate (PubChem CID 139076745) has the molecular formula C26H22CuN2O4 and a molecular weight of 490.02 g/mol. Its IUPAC name is copper 2-[(E)-C-methyl-N-[2-[(E)-1-(1-oxidonaphthalen-2-yl)ethylideneamino]oxyethoxy]carbonimidoyl]naphthalen-1-olate.
| Compound Name | copper 2-[(E)-C-methyl-N-[2-[(E)-1-(1-oxidonaphthalen-2-yl)ethylideneamino]oxyethoxy]carbonimidoyl]naphthalen-1-olate |
|---|---|
| PubChem CID | 139076745 |
| Molecular Formula | C26H22CuN2O4 |
| Molecular Weight | 490.02 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | copper 2-[(E)-C-methyl-N-[2-[(E)-1-(1-oxidonaphthalen-2-yl)ethylideneamino]oxyethoxy]carbonimidoyl]naphthalen-1-olate |
| SMILES | C/C(=N\OCCO/N=C(\C)c1ccc2ccccc2c1[O-])c1ccc2ccccc2c1[O-].[Cu+2] |
| InChI | InChI=1S/C26H24N2O4.Cu/c1-17(21-13-11-19-7-3-5-9-23(19)25(21)29)27-31-15-16-32-28-18(2)22-14-12-20-8-4-6-10-24(20)26(22)30;/h3-14,29-30H,15-16H2,1-2H3;/q;+2/p-2/b27-17+,28-18+; |
| InChIKey | SBIHJHLUKXPPPR-GHCZSDNOSA-L |
| XLogP | 4.32 |
| TPSA | 89.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|