C26H18N2O4 — CID 139077377
2-(2-carboxyphenyl)benzoate;1,10-phenanthrolin-10-ium (PubChem CID 139077377) has the molecular formula C26H18N2O4 and a molecular weight of 422.44 g/mol. Its IUPAC name is 2-(2-carboxyphenyl)benzoate;1,10-phenanthrolin-10-ium.
| Compound Name | 2-(2-carboxyphenyl)benzoate;1,10-phenanthrolin-10-ium |
|---|---|
| PubChem CID | 139077377 |
| Molecular Formula | C26H18N2O4 |
| Molecular Weight | 422.44 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 2-(2-carboxyphenyl)benzoate;1,10-phenanthrolin-10-ium |
| SMILES | O=C([O-])c1ccccc1-c1ccccc1C(=O)O.c1cnc2c(c1)ccc1ccc[nH+]c12 |
| InChI | InChI=1S/C14H10O4.C12H8N2/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1/h1-8H,(H,15,16)(H,17,18);1-8H |
| InChIKey | UASLPSSZJPSBSM-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|