C30H26CuN2O8 — CID 139078097
copper;bis(3,4-dimethoxybenzoate);1,10-phenanthroline (PubChem CID 139078097) has the molecular formula C30H26CuN2O8 and a molecular weight of 606.09 g/mol. Its IUPAC name is copper;bis(3,4-dimethoxybenzoate);1,10-phenanthroline.
| Compound Name | copper;bis(3,4-dimethoxybenzoate);1,10-phenanthroline |
|---|---|
| PubChem CID | 139078097 |
| Molecular Formula | C30H26CuN2O8 |
| Molecular Weight | 606.09 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | copper;bis(3,4-dimethoxybenzoate);1,10-phenanthroline |
| SMILES | COc1ccc(C(=O)[O-])cc1OC.COc1ccc(C(=O)[O-])cc1OC.[Cu+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C12H8N2.2C9H10O4.Cu/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;2*1-12-7-4-3-6(9(10)11)5-8(7)13-2;/h1-8H;2*3-5H,1-2H3,(H,10,11);/q;;;+2/p-2 |
| InChIKey | MJTUGKFNUGBXGW-UHFFFAOYSA-L |
| XLogP | 2.92 |
| TPSA | 142.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.09 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|