C28H22Br2N8 — CID 139078346
4-N-(3-bromophenyl)quinazoline-4,6-diamine (PubChem CID 139078346) has the molecular formula C28H22Br2N8 and a molecular weight of 630.35 g/mol. Its IUPAC name is 4-N-(3-bromophenyl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-bromophenyl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 139078346 |
| Molecular Formula | C28H22Br2N8 |
| Molecular Weight | 630.35 g/mol |
| Exact Mass | 628.03 |
| IUPAC Name | 4-N-(3-bromophenyl)quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(Nc3cccc(Br)c3)c2c1.Nc1ccc2ncnc(Nc3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/2C14H11BrN4/c2*15-9-2-1-3-11(6-9)19-14-12-7-10(16)4-5-13(12)17-8-18-14/h2*1-8H,16H2,(H,17,18,19) |
| InChIKey | RQQFLCZQQOSXPI-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 127.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.35 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|