C26H19CuN3O4 — CID 139078812
copper;(2S)-3-hydroxy-2-[(2-oxidonaphthalen-1-yl)methylideneamino]propanoate;1,10-phenanthroline (PubChem CID 139078812) has the molecular formula C26H19CuN3O4 and a molecular weight of 501.00 g/mol. Its IUPAC name is copper;(2S)-3-hydroxy-2-[(2-oxidonaphthalen-1-yl)methylideneamino]propanoate;1,10-phenanthroline.
| Compound Name | copper;(2S)-3-hydroxy-2-[(2-oxidonaphthalen-1-yl)methylideneamino]propanoate;1,10-phenanthroline |
|---|---|
| PubChem CID | 139078812 |
| Molecular Formula | C26H19CuN3O4 |
| Molecular Weight | 501.00 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | copper;(2S)-3-hydroxy-2-[(2-oxidonaphthalen-1-yl)methylideneamino]propanoate;1,10-phenanthroline |
| SMILES | O=C([O-])[C@H](CO)N=Cc1c([O-])ccc2ccccc12.[Cu+2].c1cnc2c(c1)ccc1cccnc12 |
| InChI | InChI=1S/C14H13NO4.C12H8N2.Cu/c16-8-12(14(18)19)15-7-11-10-4-2-1-3-9(10)5-6-13(11)17;1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;/h1-7,12,16-17H,8H2,(H,18,19);1-8H;/q;;+2/p-2/t12-;;/m0../s1 |
| InChIKey | UVFKPSNFGBAODP-LTCKWSDVSA-L |
| XLogP | 2.22 |
| TPSA | 121.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.00 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|