C25H21CuN3O4 — CID 139074603
copper;(2S,3R)-3-hydroxy-2-[(2-oxidonaphthalen-1-yl)methylideneamino]butanoate;2-pyridin-2-ylpyridine (PubChem CID 139074603) has the molecular formula C25H21CuN3O4 and a molecular weight of 491.01 g/mol. Its IUPAC name is copper;(2S,3R)-3-hydroxy-2-[(2-oxidonaphthalen-1-yl)methylideneamino]butanoate;2-pyridin-2-ylpyridine.
| Compound Name | copper;(2S,3R)-3-hydroxy-2-[(2-oxidonaphthalen-1-yl)methylideneamino]butanoate;2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 139074603 |
| Molecular Formula | C25H21CuN3O4 |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | copper;(2S,3R)-3-hydroxy-2-[(2-oxidonaphthalen-1-yl)methylideneamino]butanoate;2-pyridin-2-ylpyridine |
| SMILES | C[C@@H](O)[C@H](/N=C/c1c([O-])ccc2ccccc12)C(=O)[O-].[Cu+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C15H15NO4.C10H8N2.Cu/c1-9(17)14(15(19)20)16-8-12-11-5-3-2-4-10(11)6-7-13(12)18;1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h2-9,14,17-18H,1H3,(H,19,20);1-8H;/q;;+2/p-2/b16-8+;;/t9-,14+;;/m1../s1 |
| InChIKey | AUFKHYVYFQQRKE-HKYFPSSMSA-L |
| XLogP | 1.97 |
| TPSA | 121.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|