C22H24ClCuN3O6 — CID 139177150
copper;1-[3-[2-hydroxyethyl(pyridin-2-ylmethyl)amino]propyliminomethyl]naphthalen-2-olate;perchlorate (PubChem CID 139177150) has the molecular formula C22H24ClCuN3O6 and a molecular weight of 525.45 g/mol. Its IUPAC name is copper;1-[3-[2-hydroxyethyl(pyridin-2-ylmethyl)amino]propyliminomethyl]naphthalen-2-olate;perchlorate.
| Compound Name | copper;1-[3-[2-hydroxyethyl(pyridin-2-ylmethyl)amino]propyliminomethyl]naphthalen-2-olate;perchlorate |
|---|---|
| PubChem CID | 139177150 |
| Molecular Formula | C22H24ClCuN3O6 |
| Molecular Weight | 525.45 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | copper;1-[3-[2-hydroxyethyl(pyridin-2-ylmethyl)amino]propyliminomethyl]naphthalen-2-olate;perchlorate |
| SMILES | [Cu+2].[O-][Cl+3]([O-])([O-])[O-].[O-]c1ccc2ccccc2c1/C=N/CCCN(CCO)Cc1ccccn1 |
| InChI | InChI=1S/C22H25N3O2.ClHO4.Cu/c26-15-14-25(17-19-7-3-4-12-24-19)13-5-11-23-16-21-20-8-2-1-6-18(20)9-10-22(21)27;2-1(3,4)5;/h1-4,6-10,12,16,26-27H,5,11,13-15,17H2;(H,2,3,4,5);/q;;+2/p-2/b23-16+;; |
| InChIKey | PBFRDRWIZSFUSC-CGSMVWNQSA-L |
| XLogP | -2.15 |
| TPSA | 164.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.45 |
| LogP ≤ 5 | -2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|