C20H14N2O2Pd — CID 139059130
naphthalene-2,3-diolate;palladium(2+);2-pyridin-2-ylpyridine (PubChem CID 139059130) has the molecular formula C20H14N2O2Pd and a molecular weight of 420.76 g/mol. Its IUPAC name is naphthalene-2,3-diolate;palladium(2+);2-pyridin-2-ylpyridine.
| Compound Name | naphthalene-2,3-diolate;palladium(2+);2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 139059130 |
| Molecular Formula | C20H14N2O2Pd |
| Molecular Weight | 420.76 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | naphthalene-2,3-diolate;palladium(2+);2-pyridin-2-ylpyridine |
| SMILES | [O-]c1cc2ccccc2cc1[O-].[Pd+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.C10H8O2.Pd/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;11-9-5-7-3-1-2-4-8(7)6-10(9)12;/h1-8H;1-6,11-12H;/q;;+2/p-2 |
| InChIKey | AMNGKHIKIIAWBA-UHFFFAOYSA-L |
| XLogP | 3.13 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |