C24H28N2O2Pt — CID 139132626
3,5-ditert-butylbenzene-1,2-diolate;platinum(2+);2-pyridin-2-ylpyridine (PubChem CID 139132626) has the molecular formula C24H28N2O2Pt and a molecular weight of 571.58 g/mol. Its IUPAC name is 3,5-ditert-butylbenzene-1,2-diolate;platinum(2+);2-pyridin-2-ylpyridine.
| Compound Name | 3,5-ditert-butylbenzene-1,2-diolate;platinum(2+);2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 139132626 |
| Molecular Formula | C24H28N2O2Pt |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.18 |
| IUPAC Name | 3,5-ditert-butylbenzene-1,2-diolate;platinum(2+);2-pyridin-2-ylpyridine |
| SMILES | CC(C)(C)c1cc([O-])c([O-])c(C(C)(C)C)c1.[Pt+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C14H22O2.C10H8N2.Pt/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9;1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h7-8,15-16H,1-6H3;1-8H;/q;;+2/p-2 |
| InChIKey | XVWWBWMOTDGUNQ-UHFFFAOYSA-L |
| XLogP | 4.57 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |