C30H43N3OSi — CID 90894487
N-[(3,5-ditert-butyl-2-trimethylsilyloxyphenyl)methyl]-1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine (PubChem CID 90894487) has the molecular formula C30H43N3OSi and a molecular weight of 489.78 g/mol. Its IUPAC name is N-[(3,5-ditert-butyl-2-trimethylsilyloxyphenyl)methyl]-1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine.
| Compound Name | N-[(3,5-ditert-butyl-2-trimethylsilyloxyphenyl)methyl]-1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 90894487 |
| Molecular Formula | C30H43N3OSi |
| Molecular Weight | 489.78 g/mol |
| Exact Mass | 489.32 |
| IUPAC Name | N-[(3,5-ditert-butyl-2-trimethylsilyloxyphenyl)methyl]-1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine |
| SMILES | CC(C)(C)c1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O[Si](C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H43N3OSi/c1-29(2,3)24-18-23(28(34-35(7,8)9)27(19-24)30(4,5)6)20-33(21-25-14-10-12-16-31-25)22-26-15-11-13-17-32-26/h10-19H,20-22H2,1-9H3 |
| InChIKey | LYGQWVJHCCXIST-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.78 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|