C30H33N3OPd — CID 139133128
2,4-ditert-butyl-6-phenylazanidylphenolate;palladium(2+);2-pyridin-2-ylpyridine (PubChem CID 139133128) has the molecular formula C30H33N3OPd and a molecular weight of 558.03 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-phenylazanidylphenolate;palladium(2+);2-pyridin-2-ylpyridine.
| Compound Name | 2,4-ditert-butyl-6-phenylazanidylphenolate;palladium(2+);2-pyridin-2-ylpyridine |
|---|---|
| PubChem CID | 139133128 |
| Molecular Formula | C30H33N3OPd |
| Molecular Weight | 558.03 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 2,4-ditert-butyl-6-phenylazanidylphenolate;palladium(2+);2-pyridin-2-ylpyridine |
| SMILES | CC(C)(C)c1cc([N-]c2ccccc2)c([O-])c(C(C)(C)C)c1.[Pd+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C20H26NO.C10H8N2.Pd/c1-19(2,3)14-12-16(20(4,5)6)18(22)17(13-14)21-15-10-8-7-9-11-15;1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h7-13,22H,1-6H3;1-8H;/q-1;;+2/p-1 |
| InChIKey | YWBYJSOQHQCRRS-UHFFFAOYSA-M |
| XLogP | 7.83 |
| TPSA | 62.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.03 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |