C32H41N3O — CID 91456218
2,4-ditert-butyl-6-[[2-(1-methylindol-3-yl)ethyl-(pyridin-2-ylmethyl)amino]methyl]phenol (PubChem CID 91456218) has the molecular formula C32H41N3O and a molecular weight of 483.70 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[2-(1-methylindol-3-yl)ethyl-(pyridin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[2-(1-methylindol-3-yl)ethyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 91456218 |
| Molecular Formula | C32H41N3O |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.32 |
| IUPAC Name | 2,4-ditert-butyl-6-[[2-(1-methylindol-3-yl)ethyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
| SMILES | Cn1cc(CCN(Cc2ccccn2)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c2ccccc21 |
| InChI | InChI=1S/C32H41N3O/c1-31(2,3)25-18-24(30(36)28(19-25)32(4,5)6)21-35(22-26-12-10-11-16-33-26)17-15-23-20-34(7)29-14-9-8-13-27(23)29/h8-14,16,18-20,36H,15,17,21-22H2,1-7H3 |
| InChIKey | BNHHNUXIFKMNAG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|