C28H37N3O — CID 15886611
2,4-ditert-butyl-6-[[(6-methyl-2-pyridinyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol (PubChem CID 15886611) has the molecular formula C28H37N3O and a molecular weight of 431.62 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(6-methyl-2-pyridinyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(6-methyl-2-pyridinyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 15886611 |
| Molecular Formula | C28H37N3O |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(6-methyl-2-pyridinyl)methyl-(pyridin-2-ylmethyl)amino]methyl]phenol |
| SMILES | Cc1cccc(CN(Cc2ccccn2)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)n1 |
| InChI | InChI=1S/C28H37N3O/c1-20-11-10-13-24(30-20)19-31(18-23-12-8-9-14-29-23)17-21-15-22(27(2,3)4)16-25(26(21)32)28(5,6)7/h8-16,32H,17-19H2,1-7H3 |
| InChIKey | WTPIWOQLGRPKRC-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|