C12H13ClN2O2S2 — CID 139079808
ethyl 2-[[(E)-(4-chlorophenyl)methylideneamino]carbamothioylsulfanyl]acetate (PubChem CID 139079808) has the molecular formula C12H13ClN2O2S2 and a molecular weight of 316.84 g/mol. Its IUPAC name is ethyl 2-[[(E)-(4-chlorophenyl)methylideneamino]carbamothioylsulfanyl]acetate.
| Compound Name | ethyl 2-[[(E)-(4-chlorophenyl)methylideneamino]carbamothioylsulfanyl]acetate |
|---|---|
| PubChem CID | 139079808 |
| Molecular Formula | C12H13ClN2O2S2 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | ethyl 2-[[(E)-(4-chlorophenyl)methylideneamino]carbamothioylsulfanyl]acetate |
| SMILES | CCOC(=O)CSC(=S)N/N=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H13ClN2O2S2/c1-2-17-11(16)8-19-12(18)15-14-7-9-3-5-10(13)6-4-9/h3-7H,2,8H2,1H3,(H,15,18)/b14-7+ |
| InChIKey | JBJFOQYBRPCLLD-VGOFMYFVSA-N |
| XLogP | 2.84 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|