C16H16ClN3S2 — CID 6147753
1-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-3-ethylthiourea (PubChem CID 6147753) has the molecular formula C16H16ClN3S2 and a molecular weight of 349.91 g/mol. Its IUPAC name is 1-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-3-ethylthiourea.
| Compound Name | 1-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-3-ethylthiourea |
|---|---|
| PubChem CID | 6147753 |
| Molecular Formula | C16H16ClN3S2 |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 1-[(Z)-[4-(4-chlorophenyl)sulfanylphenyl]methylideneamino]-3-ethylthiourea |
| SMILES | CCNC(=S)N/N=C\c1ccc(Sc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H16ClN3S2/c1-2-18-16(21)20-19-11-12-3-7-14(8-4-12)22-15-9-5-13(17)6-10-15/h3-11H,2H2,1H3,(H2,18,20,21)/b19-11- |
| InChIKey | MBAVYGQSFTYCJV-ODLFYWEKSA-N |
| XLogP | 4.31 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|