C26H24N2O6 — CID 139079990
bis(2-carboxyphenolate);4-(2-pyridin-1-ium-4-ylethyl)pyridin-1-ium (PubChem CID 139079990) has the molecular formula C26H24N2O6 and a molecular weight of 460.49 g/mol. Its IUPAC name is bis(2-carboxyphenolate);4-(2-pyridin-1-ium-4-ylethyl)pyridin-1-ium.
| Compound Name | bis(2-carboxyphenolate);4-(2-pyridin-1-ium-4-ylethyl)pyridin-1-ium |
|---|---|
| PubChem CID | 139079990 |
| Molecular Formula | C26H24N2O6 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | bis(2-carboxyphenolate);4-(2-pyridin-1-ium-4-ylethyl)pyridin-1-ium |
| SMILES | O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].c1cc(CCc2cc[nH+]cc2)cc[nH+]1 |
| InChI | InChI=1S/C12H12N2.2C7H6O3/c1(11-3-7-13-8-4-11)2-12-5-9-14-10-6-12;2*8-6-4-2-1-3-5(6)7(9)10/h3-10H,1-2H2;2*1-4,8H,(H,9,10) |
| InChIKey | DDUIOMZXONMKBH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |