C48H24N8Zn — CID 139080870
4-[10,15,20-tris(4-cyanophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraid-5-yl]benzonitrile;zinc (PubChem CID 139080870) has the molecular formula C48H24N8Zn and a molecular weight of 778.17 g/mol. Its IUPAC name is 4-[10,15,20-tris(4-cyanophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraid-5-yl]benzonitrile;zinc.
| Compound Name | 4-[10,15,20-tris(4-cyanophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraid-5-yl]benzonitrile;zinc |
|---|---|
| PubChem CID | 139080870 |
| Molecular Formula | C48H24N8Zn |
| Molecular Weight | 778.17 g/mol |
| Exact Mass | 776.14 |
| IUPAC Name | 4-[10,15,20-tris(4-cyanophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraid-5-yl]benzonitrile;zinc |
| SMILES | N#Cc1ccc([C+]2c3ccc([n-]3)[C+](c3ccc(C#N)cc3)c3ccc([n-]3)[C+](c3ccc(C#N)cc3)c3ccc([n-]3)[C+](c3ccc(C#N)cc3)c3ccc2[n-]3)cc1.[Zn] |
| InChI | InChI=1S/C48H24N8.Zn/c49-25-29-1-9-33(10-2-29)45-37-17-19-39(53-37)46(34-11-3-30(26-50)4-12-34)41-21-23-43(55-41)48(36-15-7-32(28-52)8-16-36)44-24-22-42(56-44)47(40-20-18-38(45)54-40)35-13-5-31(27-51)6-14-35;/h1-24H; |
| InChIKey | WYHLUSUOYBEAMT-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 151.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.17 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|