C44H24I4N4Zn — CID 139060176
5,10,15,20-tetrakis(4-iodophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc (PubChem CID 139060176) has the molecular formula C44H24I4N4Zn and a molecular weight of 1181.71 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-iodophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc.
| Compound Name | 5,10,15,20-tetrakis(4-iodophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
|---|---|
| PubChem CID | 139060176 |
| Molecular Formula | C44H24I4N4Zn |
| Molecular Weight | 1181.71 g/mol |
| Exact Mass | 1179.75 |
| IUPAC Name | 5,10,15,20-tetrakis(4-iodophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
| SMILES | Ic1ccc([C+]2c3ccc([n-]3)[C+](c3ccc(I)cc3)c3ccc([n-]3)[C+](c3ccc(I)cc3)c3ccc([n-]3)[C+](c3ccc(I)cc3)c3ccc2[n-]3)cc1.[Zn] |
| InChI | InChI=1S/C44H24I4N4.Zn/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27;/h1-24H; |
| InChIKey | HHRVCJLPQHKGGN-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1181.71 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|