C70H46Cl4CuN4 — CID 139074335
copper;2,3,5,10,12,13,15,20-octakis-phenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;1,1,2,2-tetrachloroethane (PubChem CID 139074335) has the molecular formula C70H46Cl4CuN4 and a molecular weight of 1148.52 g/mol. Its IUPAC name is copper;2,3,5,10,12,13,15,20-octakis-phenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;1,1,2,2-tetrachloroethane.
| Compound Name | copper;2,3,5,10,12,13,15,20-octakis-phenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;1,1,2,2-tetrachloroethane |
|---|---|
| PubChem CID | 139074335 |
| Molecular Formula | C70H46Cl4CuN4 |
| Molecular Weight | 1148.52 g/mol |
| Exact Mass | 1145.18 |
| IUPAC Name | copper;2,3,5,10,12,13,15,20-octakis-phenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;1,1,2,2-tetrachloroethane |
| SMILES | ClC(Cl)C(Cl)Cl.[Cu].c1ccc(-c2c3[n-]c(c2-c2ccccc2)[C+](c2ccccc2)c2ccc([n-]2)[C+](c2ccccc2)c2[n-]c(c(-c4ccccc4)c2-c2ccccc2)[C+](c2ccccc2)c2ccc([n-]2)[C+]3c2ccccc2)cc1 |
| InChI | InChI=1S/C68H44N4.C2H2Cl4.Cu/c1-9-25-45(26-10-1)57-53-41-42-54(69-53)58(46-27-11-2-12-28-46)67-63(51-37-21-7-22-38-51)64(52-39-23-8-24-40-52)68(72-67)60(48-31-15-4-16-32-48)56-44-43-55(70-56)59(47-29-13-3-14-30-47)66-62(50-35-19-6-20-36-50)61(65(57)71-66)49-33-17-5-18-34-49;3-1(4)2(5)6;/h1-44H;1-2H; |
| InChIKey | JZJOPRXANMYKNQ-UHFFFAOYSA-N |
| XLogP | 17.16 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1148.52 |
| LogP ≤ 5 | 17.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|