C47H35N5OZn — CID 139068876
N,N-dimethylformamide;5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc (PubChem CID 139068876) has the molecular formula C47H35N5OZn and a molecular weight of 751.22 g/mol. Its IUPAC name is N,N-dimethylformamide;5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc.
| Compound Name | N,N-dimethylformamide;5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
|---|---|
| PubChem CID | 139068876 |
| Molecular Formula | C47H35N5OZn |
| Molecular Weight | 751.22 g/mol |
| Exact Mass | 749.21 |
| IUPAC Name | N,N-dimethylformamide;5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
| SMILES | CN(C)C=O.[Zn].c1ccc([C+]2c3ccc([n-]3)[C+](c3ccccc3)c3ccc([n-]3)[C+](c3ccccc3)c3ccc([n-]3)[C+](c3ccccc3)c3ccc2[n-]3)cc1 |
| InChI | InChI=1S/C44H28N4.C3H7NO.Zn/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;1-4(2)3-5;/h1-28H;3H,1-2H3; |
| InChIKey | WULLTLFANOOHIV-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 76.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.22 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|