C56H52N4O6Zn — CID 139085855
1,4,7,10,13,16-hexaoxacyclooctadecane;5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc (PubChem CID 139085855) has the molecular formula C56H52N4O6Zn and a molecular weight of 942.44 g/mol. Its IUPAC name is 1,4,7,10,13,16-hexaoxacyclooctadecane;5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc.
| Compound Name | 1,4,7,10,13,16-hexaoxacyclooctadecane;5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
|---|---|
| PubChem CID | 139085855 |
| Molecular Formula | C56H52N4O6Zn |
| Molecular Weight | 942.44 g/mol |
| Exact Mass | 940.32 |
| IUPAC Name | 1,4,7,10,13,16-hexaoxacyclooctadecane;5,10,15,20-tetraphenylporphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
| SMILES | C1COCCOCCOCCOCCOCCO1.[Zn].c1ccc([C+]2c3ccc([n-]3)[C+](c3ccccc3)c3ccc([n-]3)[C+](c3ccccc3)c3ccc([n-]3)[C+](c3ccccc3)c3ccc2[n-]3)cc1 |
| InChI | InChI=1S/C44H28N4.C12H24O6.Zn/c1-5-13-29(14-6-1)41-33-21-23-35(45-33)42(30-15-7-2-8-16-30)37-25-27-39(47-37)44(32-19-11-4-12-20-32)40-28-26-38(48-40)43(31-17-9-3-10-18-31)36-24-22-34(41)46-36;1-2-14-5-6-16-9-10-18-12-11-17-8-7-15-4-3-13-1;/h1-28H;1-12H2; |
| InChIKey | HLWIWNARHGYMFA-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 111.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.44 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|