C50H29Cl4N5O2Zn — CID 139066023
nitrobenzene;5,10,15,20-tetrakis(4-chlorophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc (PubChem CID 139066023) has the molecular formula C50H29Cl4N5O2Zn and a molecular weight of 939.02 g/mol. Its IUPAC name is nitrobenzene;5,10,15,20-tetrakis(4-chlorophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc.
| Compound Name | nitrobenzene;5,10,15,20-tetrakis(4-chlorophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
|---|---|
| PubChem CID | 139066023 |
| Molecular Formula | C50H29Cl4N5O2Zn |
| Molecular Weight | 939.02 g/mol |
| Exact Mass | 935.04 |
| IUPAC Name | nitrobenzene;5,10,15,20-tetrakis(4-chlorophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
| SMILES | Clc1ccc([C+]2c3ccc([n-]3)[C+](c3ccc(Cl)cc3)c3ccc([n-]3)[C+](c3ccc(Cl)cc3)c3ccc([n-]3)[C+](c3ccc(Cl)cc3)c3ccc2[n-]3)cc1.O=[N+]([O-])c1ccccc1.[Zn] |
| InChI | InChI=1S/C44H24Cl4N4.C6H5NO2.Zn/c45-29-9-1-25(2-10-29)41-33-17-19-35(49-33)42(26-3-11-30(46)12-4-26)37-21-23-39(51-37)44(28-7-15-32(48)16-8-28)40-24-22-38(52-40)43(36-20-18-34(41)50-36)27-5-13-31(47)14-6-27;8-7(9)6-4-2-1-3-5-6;/h1-24H;1-5H; |
| InChIKey | TUVAKNSOMGTWQJ-UHFFFAOYSA-N |
| XLogP | 12.11 |
| TPSA | 99.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.02 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|