C46H30N6O4Zn — CID 139145434
5,15-bis(4-methylphenyl)-10,20-bis(4-nitrophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc (PubChem CID 139145434) has the molecular formula C46H30N6O4Zn and a molecular weight of 796.17 g/mol. Its IUPAC name is 5,15-bis(4-methylphenyl)-10,20-bis(4-nitrophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc.
| Compound Name | 5,15-bis(4-methylphenyl)-10,20-bis(4-nitrophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
|---|---|
| PubChem CID | 139145434 |
| Molecular Formula | C46H30N6O4Zn |
| Molecular Weight | 796.17 g/mol |
| Exact Mass | 794.16 |
| IUPAC Name | 5,15-bis(4-methylphenyl)-10,20-bis(4-nitrophenyl)porphyrin-5,10,15,20-tetraylium-21,22,23,24-tetraide;zinc |
| SMILES | Cc1ccc([C+]2c3ccc([n-]3)[C+](c3ccc([N+](=O)[O-])cc3)c3ccc([n-]3)[C+](c3ccc(C)cc3)c3ccc([n-]3)[C+](c3ccc([N+](=O)[O-])cc3)c3ccc2[n-]3)cc1.[Zn] |
| InChI | InChI=1S/C46H30N6O4.Zn/c1-27-3-7-29(8-4-27)43-35-19-23-39(47-35)45(31-11-15-33(16-12-31)51(53)54)41-25-21-37(49-41)44(30-9-5-28(2)6-10-30)38-22-26-42(50-38)46(40-24-20-36(43)48-40)32-13-17-34(18-14-32)52(55)56;/h3-26H,1-2H3; |
| InChIKey | GRDFOQVRPLKMIZ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 142.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.17 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|