C32H48O6 — CID 139081723
methyl 2-[(3aR,6R,8aR)-3a,8a-dimethyl-8-oxo-2,3,4,5,6,7-hexahydro-1H-azulen-6-yl]prop-2-enoate (PubChem CID 139081723) has the molecular formula C32H48O6 and a molecular weight of 528.73 g/mol. Its IUPAC name is methyl 2-[(3aR,6R,8aR)-3a,8a-dimethyl-8-oxo-2,3,4,5,6,7-hexahydro-1H-azulen-6-yl]prop-2-enoate.
| Compound Name | methyl 2-[(3aR,6R,8aR)-3a,8a-dimethyl-8-oxo-2,3,4,5,6,7-hexahydro-1H-azulen-6-yl]prop-2-enoate |
|---|---|
| PubChem CID | 139081723 |
| Molecular Formula | C32H48O6 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.35 |
| IUPAC Name | methyl 2-[(3aR,6R,8aR)-3a,8a-dimethyl-8-oxo-2,3,4,5,6,7-hexahydro-1H-azulen-6-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@]2(C)CCC[C@@]2(C)C(=O)C1.C=C(C(=O)OC)[C@@H]1CC[C@@]2(C)CCC[C@@]2(C)C(=O)C1 |
| InChI | InChI=1S/2C16H24O3/c2*1-11(14(18)19-4)12-6-9-15(2)7-5-8-16(15,3)13(17)10-12/h2*12H,1,5-10H2,2-4H3/t2*12-,15-,16+/m11/s1 |
| InChIKey | XVJDXLKRAAPISP-MFCSYYKJSA-N |
| XLogP | 6.56 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|