C16H24O3 — CID 123413228
methyl 2-(3a,8a-dimethyl-8-oxo-2,3,4,5,6,7-hexahydro-1H-azulen-6-yl)prop-2-enoate (PubChem CID 123413228) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl 2-(3a,8a-dimethyl-8-oxo-2,3,4,5,6,7-hexahydro-1H-azulen-6-yl)prop-2-enoate.
| Compound Name | methyl 2-(3a,8a-dimethyl-8-oxo-2,3,4,5,6,7-hexahydro-1H-azulen-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 123413228 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl 2-(3a,8a-dimethyl-8-oxo-2,3,4,5,6,7-hexahydro-1H-azulen-6-yl)prop-2-enoate |
| SMILES | C=C(C(=O)OC)C1CCC2(C)CCCC2(C)C(=O)C1 |
| InChI | InChI=1S/C16H24O3/c1-11(14(18)19-4)12-6-9-15(2)7-5-8-16(15,3)13(17)10-12/h12H,1,5-10H2,2-4H3 |
| InChIKey | VNAWGVYGWUIQLH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|