C18H28O4 — CID 163046515
methyl 2-[(3S,3aS,5R,8S,8aS)-3-acetyloxy-3a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-5-yl]prop-2-enoate (PubChem CID 163046515) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is methyl 2-[(3S,3aS,5R,8S,8aS)-3-acetyloxy-3a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-5-yl]prop-2-enoate.
| Compound Name | methyl 2-[(3S,3aS,5R,8S,8aS)-3-acetyloxy-3a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-5-yl]prop-2-enoate |
|---|---|
| PubChem CID | 163046515 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | methyl 2-[(3S,3aS,5R,8S,8aS)-3-acetyloxy-3a,8-dimethyl-2,3,4,5,6,7,8,8a-octahydro-1H-azulen-5-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@H](C)[C@@H]2CC[C@H](OC(C)=O)[C@@]2(C)C1 |
| InChI | InChI=1S/C18H28O4/c1-11-6-7-14(12(2)17(20)21-5)10-18(4)15(11)8-9-16(18)22-13(3)19/h11,14-16H,2,6-10H2,1,3-5H3/t11-,14+,15-,16-,18-/m0/s1 |
| InChIKey | PSCUINKTRVCNJK-OZZRIEOOSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|