C31H36N2O8 — CID 139082219
(5R,5aR,8aS,9S)-5-[[4-(dimethylamino)phenyl]methylamino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one;methanol (PubChem CID 139082219) has the molecular formula C31H36N2O8 and a molecular weight of 564.64 g/mol. Its IUPAC name is (5R,5aR,8aS,9S)-5-[[4-(dimethylamino)phenyl]methylamino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one;methanol.
| Compound Name | (5R,5aR,8aS,9S)-5-[[4-(dimethylamino)phenyl]methylamino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one;methanol |
|---|---|
| PubChem CID | 139082219 |
| Molecular Formula | C31H36N2O8 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.25 |
| IUPAC Name | (5R,5aR,8aS,9S)-5-[[4-(dimethylamino)phenyl]methylamino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[6,5-f][1,3]benzodioxol-8-one;methanol |
| SMILES | CO.COc1cc([C@H]2c3cc4c(cc3[C@H](NCc3ccc(N(C)C)cc3)[C@@H]3COC(=O)[C@@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C30H32N2O7.CH4O/c1-32(2)18-7-5-16(6-8-18)13-31-28-20-12-23-22(38-15-39-23)11-19(20)26(27-21(28)14-37-30(27)34)17-9-24(35-3)29(33)25(10-17)36-4;1-2/h5-12,21,26-28,31,33H,13-15H2,1-4H3;2H,1H3/t21-,26+,27-,28+;/m1./s1 |
| InChIKey | WLXBPNIRCJZGTN-ANADTZFHSA-N |
| XLogP | 3.58 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|