C29H30N2O7 — CID 90661874
(5S,5aS,8aR,9R)-5-[4-(dimethylamino)anilino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one (PubChem CID 90661874) has the molecular formula C29H30N2O7 and a molecular weight of 518.57 g/mol. Its IUPAC name is (5S,5aS,8aR,9R)-5-[4-(dimethylamino)anilino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one.
| Compound Name | (5S,5aS,8aR,9R)-5-[4-(dimethylamino)anilino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
|---|---|
| PubChem CID | 90661874 |
| Molecular Formula | C29H30N2O7 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (5S,5aS,8aR,9R)-5-[4-(dimethylamino)anilino]-9-(4-hydroxy-3,5-dimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-8-one |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@@H](Nc3ccc(N(C)C)cc3)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1O |
| InChI | InChI=1S/C29H30N2O7/c1-31(2)17-7-5-16(6-8-17)30-27-19-12-22-21(37-14-38-22)11-18(19)25(26-20(27)13-36-29(26)33)15-9-23(34-3)28(32)24(10-15)35-4/h5-12,20,25-27,30,32H,13-14H2,1-4H3/t20-,25+,26-,27+/m0/s1 |
| InChIKey | AXNFRDNSHZPUNP-ULBKPHCJSA-N |
| XLogP | 4.29 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|