C24H26O6S2 — CID 139083328
2,5-diphenylterephthalic acid;bis(trideuterio(trideuteriomethylsulfinyl)methane) (PubChem CID 139083328) has the molecular formula C24H26O6S2 and a molecular weight of 486.67 g/mol. Its IUPAC name is 2,5-diphenylterephthalic acid;bis(trideuterio(trideuteriomethylsulfinyl)methane).
| Compound Name | 2,5-diphenylterephthalic acid;bis(trideuterio(trideuteriomethylsulfinyl)methane) |
|---|---|
| PubChem CID | 139083328 |
| Molecular Formula | C24H26O6S2 |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 2,5-diphenylterephthalic acid;bis(trideuterio(trideuteriomethylsulfinyl)methane) |
| SMILES | O=C(O)c1cc(-c2ccccc2)c(C(=O)O)cc1-c1ccccc1.[2H]C([2H])([2H])S(=O)C([2H])([2H])[2H].[2H]C([2H])([2H])S(=O)C([2H])([2H])[2H] |
| InChI | InChI=1S/C20H14O4.2C2H6OS/c21-19(22)17-12-16(14-9-5-2-6-10-14)18(20(23)24)11-15(17)13-7-3-1-4-8-13;2*1-4(2)3/h1-12H,(H,21,22)(H,23,24);2*1-2H3/i;2*1D3,2D3 |
| InChIKey | WEJJZGVTRAWAHH-RGPFGFIDSA-N |
| XLogP | 4.41 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |