2,5-dipyridin-4-ylterephthalic acid

C18H12N2O4 — CID 163197795

IUPAC2,5-dipyridin-4-ylterephthalic acid
SMILESO=C(O)c1cc(-c2ccncc2)c(C(=O)O)cc1-c1ccncc1
InChIInChI=1S/C18H12N2O4/c21-17(22)15-10-14(12-3-7-20-8-4-12)16(18(23)24)9-13(15)11-1-5-19-6-2-11/h1-10H,(H,21,22)(H,23,24)
InChIKeyFYEZAERADNCKKB-UHFFFAOYSA-N
MW320.30 g/mol
LogP3.21
Rot. Bonds4

About 2,5-dipyridin-4-ylterephthalic acid

2,5-dipyridin-4-ylterephthalic acid (PubChem CID 163197795) has the molecular formula C18H12N2O4 and a molecular weight of 320.30 g/mol. Its IUPAC name is 2,5-dipyridin-4-ylterephthalic acid.

Molecular Properties

Compound Name2,5-dipyridin-4-ylterephthalic acid
PubChem CID163197795
Molecular FormulaC18H12N2O4
Molecular Weight320.30 g/mol
Exact Mass320.08
IUPAC Name2,5-dipyridin-4-ylterephthalic acid
SMILESO=C(O)c1cc(-c2ccncc2)c(C(=O)O)cc1-c1ccncc1
InChIInChI=1S/C18H12N2O4/c21-17(22)15-10-14(12-3-7-20-8-4-12)16(18(23)24)9-13(15)11-1-5-19-6-2-11/h1-10H,(H,21,22)(H,23,24)
InChIKeyFYEZAERADNCKKB-UHFFFAOYSA-N
XLogP3.21
TPSA100.38 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.30
LogP ≤ 53.21
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2,5-dipyridin-4-ylterephthalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dipyridin-4-ylterephthalic acid?
The IUPAC name of 2,5-dipyridin-4-ylterephthalic acid (CID 163197795) is 2,5-dipyridin-4-ylterephthalic acid.
What is the SMILES notation for 2,5-dipyridin-4-ylterephthalic acid?
The canonical SMILES for 2,5-dipyridin-4-ylterephthalic acid is O=C(O)c1cc(-c2ccncc2)c(C(=O)O)cc1-c1ccncc1.
What is the InChIKey of 2,5-dipyridin-4-ylterephthalic acid?
The InChIKey is FYEZAERADNCKKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12N2O4/c21-17(22)15-10-14(12-3-7-20-8-4-12)16(18(23)24)9-13(15)11-1-5-19-6-2-11/h1-10H,(H,21,22)(H,23,24).
What are the key properties of 2,5-dipyridin-4-ylterephthalic acid?
2,5-dipyridin-4-ylterephthalic acid has a molecular weight of 320.30 g/mol, XLogP of 3.21, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dipyridin-4-ylterephthalic acid is sourced from PubChem (CID 163197795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).