About (4-acetamidophenyl)azanium;nitrate;hydrate
(4-acetamidophenyl)azanium;nitrate;hydrate (PubChem CID 139083871) has the molecular formula C8H13N3O5
and a molecular weight of 231.21 g/mol. Its IUPAC name is (4-acetamidophenyl)azanium;nitrate;hydrate.
Molecular Properties
| Compound Name | (4-acetamidophenyl)azanium;nitrate;hydrate |
| PubChem CID | 139083871 |
| Molecular Formula | C8H13N3O5 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (4-acetamidophenyl)azanium;nitrate;hydrate |
| SMILES | CC(=O)Nc1ccc([NH3+])cc1.O.O=[N+]([O-])[O-] |
| InChI | InChI=1S/C8H10N2O.NO3.H2O/c1-6(11)10-8-4-2-7(9)3-5-8;2-1(3)4;/h2-5H,9H2,1H3,(H,10,11);;1H2/q;-1;/p+1 |
| InChIKey | GCEJCLUCAQPZDS-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 154.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl)azanium;nitrate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl)azanium;nitrate;hydrate?
The IUPAC name of (4-acetamidophenyl)azanium;nitrate;hydrate (CID 139083871) is (4-acetamidophenyl)azanium;nitrate;hydrate.
What is the SMILES notation for (4-acetamidophenyl)azanium;nitrate;hydrate?
The canonical SMILES for (4-acetamidophenyl)azanium;nitrate;hydrate is CC(=O)Nc1ccc([NH3+])cc1.O.O=[N+]([O-])[O-].
What is the InChIKey of (4-acetamidophenyl)azanium;nitrate;hydrate?
The InChIKey is GCEJCLUCAQPZDS-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H10N2O.NO3.H2O/c1-6(11)10-8-4-2-7(9)3-5-8;2-1(3)4;/h2-5H,9H2,1H3,(H,10,11);;1H2/q;-1;/p+1.
What are the key properties of (4-acetamidophenyl)azanium;nitrate;hydrate?
(4-acetamidophenyl)azanium;nitrate;hydrate has a molecular weight of 231.21 g/mol, XLogP of -0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl)azanium;nitrate;hydrate is sourced from PubChem (CID 139083871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).