C29H22F2O2S — CID 139084254
(E)-1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one (PubChem CID 139084254) has the molecular formula C29H22F2O2S and a molecular weight of 472.56 g/mol. Its IUPAC name is (E)-1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139084254 |
| Molecular Formula | C29H22F2O2S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | (E)-1-[2,4-bis(4-fluorophenyl)-6-methoxyphenyl]-3-(4-methylsulfanylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)c1C(=O)/C=C/c1ccc(SC)cc1 |
| InChI | InChI=1S/C29H22F2O2S/c1-33-28-18-22(20-6-10-23(30)11-7-20)17-26(21-8-12-24(31)13-9-21)29(28)27(32)16-5-19-3-14-25(34-2)15-4-19/h3-18H,1-2H3/b16-5+ |
| InChIKey | FRLANYTXPGQCEK-FZSIALSZSA-N |
| XLogP | 7.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|