C22H30N2O3 — CID 139084255
(1R,2S,4R,6S,7S,10S,11R)-6-imidazol-1-yl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one;hydrate (PubChem CID 139084255) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is (1R,2S,4R,6S,7S,10S,11R)-6-imidazol-1-yl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one;hydrate.
| Compound Name | (1R,2S,4R,6S,7S,10S,11R)-6-imidazol-1-yl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one;hydrate |
|---|---|
| PubChem CID | 139084255 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (1R,2S,4R,6S,7S,10S,11R)-6-imidazol-1-yl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one;hydrate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1C[C@H]1O[C@]12n1ccnc1.O |
| InChI | InChI=1S/C22H28N2O2.H2O/c1-20-7-5-15(25)11-14(20)3-4-16-17(20)6-8-21(2)18(16)12-19-22(21,26-19)24-10-9-23-13-24;/h9-11,13,16-19H,3-8,12H2,1-2H3;1H2/t16-,17+,18+,19-,20+,21+,22-;/m1./s1 |
| InChIKey | KRMWYYJYHJCYOZ-HZECAUSDSA-N |
| XLogP | 3.25 |
| TPSA | 78.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|