C21H30O2 — CID 54069337
(6S)-6-ethyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one (PubChem CID 54069337) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is (6S)-6-ethyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one.
| Compound Name | (6S)-6-ethyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one |
|---|---|
| PubChem CID | 54069337 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | (6S)-6-ethyl-7,11-dimethyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one |
| SMILES | CC[C@@]12OC1CC1C3CCC4=CC(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C21H30O2/c1-4-21-18(23-21)12-17-15-6-5-13-11-14(22)7-9-19(13,2)16(15)8-10-20(17,21)3/h11,15-18H,4-10,12H2,1-3H3/t15?,16?,17?,18?,19?,20?,21-/m1/s1 |
| InChIKey | MFGVIAQCYPZGLW-ILZKQPLKSA-N |
| XLogP | 4.68 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|