C22H32O3 — CID 54423530
(11S)-6-butyl-11-hydroxy-7-methyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one (PubChem CID 54423530) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (11S)-6-butyl-11-hydroxy-7-methyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one.
| Compound Name | (11S)-6-butyl-11-hydroxy-7-methyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one |
|---|---|
| PubChem CID | 54423530 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (11S)-6-butyl-11-hydroxy-7-methyl-5-oxapentacyclo[8.8.0.02,7.04,6.011,16]octadec-15-en-14-one |
| SMILES | CCCCC12OC1CC1C3CCC4=CC(=O)CC[C@]4(O)C3CCC12C |
| InChI | InChI=1S/C22H32O3/c1-3-4-9-22-19(25-22)13-18-16-6-5-14-12-15(23)7-11-21(14,24)17(16)8-10-20(18,22)2/h12,16-19,24H,3-11,13H2,1-2H3/t16?,17?,18?,19?,20?,21-,22?/m1/s1 |
| InChIKey | WCMCQBHZUBWQOR-ZVMTYZDZSA-N |
| XLogP | 4.18 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|