C21H15F2N3O2 — CID 139084581
(3S)-3,5-bis(4-fluorophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazole (PubChem CID 139084581) has the molecular formula C21H15F2N3O2 and a molecular weight of 379.37 g/mol. Its IUPAC name is (3S)-3,5-bis(4-fluorophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazole.
| Compound Name | (3S)-3,5-bis(4-fluorophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 139084581 |
| Molecular Formula | C21H15F2N3O2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | (3S)-3,5-bis(4-fluorophenyl)-2-(4-nitrophenyl)-3,4-dihydropyrazole |
| SMILES | O=[N+]([O-])c1ccc(N2N=C(c3ccc(F)cc3)C[C@H]2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H15F2N3O2/c22-16-5-1-14(2-6-16)20-13-21(15-3-7-17(23)8-4-15)25(24-20)18-9-11-19(12-10-18)26(27)28/h1-12,21H,13H2/t21-/m0/s1 |
| InChIKey | QLSAIPYFEZGJBG-NRFANRHFSA-N |
| XLogP | 5.23 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|