C37H51BrN2O10 — CID 139085096
bis(2-butoxyethyl) 2,6-dimethyl-4-[1-[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl]pyridin-1-ium-3-yl]-1,4-dihydropyridine-3,5-dicarboxylate bromide (PubChem CID 139085096) has the molecular formula C37H51BrN2O10 and a molecular weight of 763.72 g/mol. Its IUPAC name is bis(2-butoxyethyl) 2,6-dimethyl-4-[1-[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl]pyridin-1-ium-3-yl]-1,4-dihydropyridine-3,5-dicarboxylate bromide.
| Compound Name | bis(2-butoxyethyl) 2,6-dimethyl-4-[1-[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl]pyridin-1-ium-3-yl]-1,4-dihydropyridine-3,5-dicarboxylate bromide |
|---|---|
| PubChem CID | 139085096 |
| Molecular Formula | C37H51BrN2O10 |
| Molecular Weight | 763.72 g/mol |
| Exact Mass | 762.27 |
| IUPAC Name | bis(2-butoxyethyl) 2,6-dimethyl-4-[1-[2-oxo-2-(3,4,5-trimethoxyphenyl)ethyl]pyridin-1-ium-3-yl]-1,4-dihydropyridine-3,5-dicarboxylate bromide |
| SMILES | CCCCOCCOC(=O)C1=C(C)NC(C)=C(C(=O)OCCOCCCC)C1c1ccc[n+](CC(=O)c2cc(OC)c(OC)c(OC)c2)c1.[Br-] |
| InChI | InChI=1S/C37H50N2O10.BrH/c1-8-10-15-46-17-19-48-36(41)32-25(3)38-26(4)33(37(42)49-20-18-47-16-11-9-2)34(32)27-13-12-14-39(23-27)24-29(40)28-21-30(43-5)35(45-7)31(22-28)44-6;/h12-14,21-23,34H,8-11,15-20,24H2,1-7H3;1H |
| InChIKey | PXEWSMLPZJNKAT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 131.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.72 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|