C24H36N4S3 — CID 139086263
N-(thiophen-2-ylmethyl)-N',N'-bis[3-(thiophen-2-ylmethylamino)propyl]propane-1,3-diamine (PubChem CID 139086263) has the molecular formula C24H36N4S3 and a molecular weight of 476.78 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)-N',N'-bis[3-(thiophen-2-ylmethylamino)propyl]propane-1,3-diamine.
| Compound Name | N-(thiophen-2-ylmethyl)-N',N'-bis[3-(thiophen-2-ylmethylamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 139086263 |
| Molecular Formula | C24H36N4S3 |
| Molecular Weight | 476.78 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-(thiophen-2-ylmethyl)-N',N'-bis[3-(thiophen-2-ylmethylamino)propyl]propane-1,3-diamine |
| SMILES | c1csc(CNCCCN(CCCNCc2cccs2)CCCNCc2cccs2)c1 |
| InChI | InChI=1S/C24H36N4S3/c1-7-22(29-16-1)19-25-10-4-13-28(14-5-11-26-20-23-8-2-17-30-23)15-6-12-27-21-24-9-3-18-31-24/h1-3,7-9,16-18,25-27H,4-6,10-15,19-21H2 |
| InChIKey | CMZVCBHSUAHDQW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.78 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|