C36H36O4 — CID 139086519
(1R,2S)-2-(4-methoxyphenyl)-4-methyl-1,2-dihydronaphthalen-1-ol (PubChem CID 139086519) has the molecular formula C36H36O4 and a molecular weight of 532.68 g/mol. Its IUPAC name is (1R,2S)-2-(4-methoxyphenyl)-4-methyl-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1R,2S)-2-(4-methoxyphenyl)-4-methyl-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 139086519 |
| Molecular Formula | C36H36O4 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | (1R,2S)-2-(4-methoxyphenyl)-4-methyl-1,2-dihydronaphthalen-1-ol |
| SMILES | COc1ccc([C@@H]2C=C(C)c3ccccc3[C@@H]2O)cc1.COc1ccc([C@@H]2C=C(C)c3ccccc3[C@@H]2O)cc1 |
| InChI | InChI=1S/2C18H18O2/c2*1-12-11-17(13-7-9-14(20-2)10-8-13)18(19)16-6-4-3-5-15(12)16/h2*3-11,17-19H,1-2H3/t2*17-,18-/m00/s1 |
| InChIKey | MOVXPPUQQNQRQH-VIIMOKPPSA-N |
| XLogP | 7.86 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |