C14H12N2O3 — CID 139086549
ethanol;1,10-phenanthroline-5,6-dione (PubChem CID 139086549) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is ethanol;1,10-phenanthroline-5,6-dione.
| Compound Name | ethanol;1,10-phenanthroline-5,6-dione |
|---|---|
| PubChem CID | 139086549 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | ethanol;1,10-phenanthroline-5,6-dione |
| SMILES | CCO.O=C1C(=O)c2cccnc2-c2ncccc21 |
| InChI | InChI=1S/C12H6N2O2.C2H6O/c15-11-7-3-1-5-13-9(7)10-8(12(11)16)4-2-6-14-10;1-2-3/h1-6H;3H,2H2,1H3 |
| InChIKey | JRNCIJPXYWVJFC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|