C26H16CuN2O2S2 — CID 139087600
copper bis(2-(1,3-benzothiazol-2-yl)phenolate) (PubChem CID 139087600) has the molecular formula C26H16CuN2O2S2 and a molecular weight of 516.11 g/mol. Its IUPAC name is copper bis(2-(1,3-benzothiazol-2-yl)phenolate).
| Compound Name | copper bis(2-(1,3-benzothiazol-2-yl)phenolate) |
|---|---|
| PubChem CID | 139087600 |
| Molecular Formula | C26H16CuN2O2S2 |
| Molecular Weight | 516.11 g/mol |
| Exact Mass | 514.99 |
| IUPAC Name | copper bis(2-(1,3-benzothiazol-2-yl)phenolate) |
| SMILES | [Cu+2].[O-]c1ccccc1-c1nc2ccccc2s1.[O-]c1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/2C13H9NOS.Cu/c2*15-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)16-13;/h2*1-8,15H;/q;;+2/p-2 |
| InChIKey | ONRDCBKXOZXJNU-UHFFFAOYSA-L |
| XLogP | 6.07 |
| TPSA | 71.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.11 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |