C32H30N4O2S4 — CID 139087967
2-[(E)-N-[(Z)-[benzylsulfanyl-[[(Z)-C-benzylsulfanyl-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]carbonimidoyl]disulfanyl]methylidene]amino]-C-methylcarbonimidoyl]phenol (PubChem CID 139087967) has the molecular formula C32H30N4O2S4 and a molecular weight of 630.89 g/mol. Its IUPAC name is 2-[(E)-N-[(Z)-[benzylsulfanyl-[[(Z)-C-benzylsulfanyl-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]carbonimidoyl]disulfanyl]methylidene]amino]-C-methylcarbonimidoyl]phenol.
| Compound Name | 2-[(E)-N-[(Z)-[benzylsulfanyl-[[(Z)-C-benzylsulfanyl-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]carbonimidoyl]disulfanyl]methylidene]amino]-C-methylcarbonimidoyl]phenol |
|---|---|
| PubChem CID | 139087967 |
| Molecular Formula | C32H30N4O2S4 |
| Molecular Weight | 630.89 g/mol |
| Exact Mass | 630.13 |
| IUPAC Name | 2-[(E)-N-[(Z)-[benzylsulfanyl-[[(Z)-C-benzylsulfanyl-N-[(E)-1-(2-hydroxyphenyl)ethylideneamino]carbonimidoyl]disulfanyl]methylidene]amino]-C-methylcarbonimidoyl]phenol |
| SMILES | C/C(=N\N=C(\SCc1ccccc1)SS/C(=N\N=C(/C)c1ccccc1O)SCc1ccccc1)c1ccccc1O |
| InChI | InChI=1S/C32H30N4O2S4/c1-23(27-17-9-11-19-29(27)37)33-35-31(39-21-25-13-5-3-6-14-25)41-42-32(40-22-26-15-7-4-8-16-26)36-34-24(2)28-18-10-12-20-30(28)38/h3-20,37-38H,21-22H2,1-2H3/b33-23+,34-24+,35-31-,36-32- |
| InChIKey | KTDVYECFNJZJFP-KDPGFMKLSA-N |
| XLogP | 9.21 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.89 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|