C24H21NO3S — CID 139088647
(3aS,4R,4aR,7aR)-2-methyl-5-oxo-4,6-diphenyl-3a,4a,7,7a-tetrahydrothieno[3,2-f]isoindole-4-carboxylic acid (PubChem CID 139088647) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is (3aS,4R,4aR,7aR)-2-methyl-5-oxo-4,6-diphenyl-3a,4a,7,7a-tetrahydrothieno[3,2-f]isoindole-4-carboxylic acid.
| Compound Name | (3aS,4R,4aR,7aR)-2-methyl-5-oxo-4,6-diphenyl-3a,4a,7,7a-tetrahydrothieno[3,2-f]isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 139088647 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | (3aS,4R,4aR,7aR)-2-methyl-5-oxo-4,6-diphenyl-3a,4a,7,7a-tetrahydrothieno[3,2-f]isoindole-4-carboxylic acid |
| SMILES | CC1=C[C@@H]2C(=C[C@@H]3CN(c4ccccc4)C(=O)[C@H]3[C@]2(C(=O)O)c2ccccc2)S1 |
| InChI | InChI=1S/C24H21NO3S/c1-15-12-19-20(29-15)13-16-14-25(18-10-6-3-7-11-18)22(26)21(16)24(19,23(27)28)17-8-4-2-5-9-17/h2-13,16,19,21H,14H2,1H3,(H,27,28)/t16-,19-,21+,24+/m1/s1 |
| InChIKey | BORLWFLJVNEPRJ-LCUYEHBISA-N |
| XLogP | 4.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |