C18H17NO3 — CID 139094351
(2S)-2-[(3S)-1,3-dimethyl-2-oxoindol-3-yl]-2-phenylacetic acid (PubChem CID 139094351) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is (2S)-2-[(3S)-1,3-dimethyl-2-oxoindol-3-yl]-2-phenylacetic acid.
| Compound Name | (2S)-2-[(3S)-1,3-dimethyl-2-oxoindol-3-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 139094351 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (2S)-2-[(3S)-1,3-dimethyl-2-oxoindol-3-yl]-2-phenylacetic acid |
| SMILES | CN1C(=O)[C@@](C)([C@@H](C(=O)O)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H17NO3/c1-18(15(16(20)21)12-8-4-3-5-9-12)13-10-6-7-11-14(13)19(2)17(18)22/h3-11,15H,1-2H3,(H,20,21)/t15-,18-/m1/s1 |
| InChIKey | XCIKQNUEOGXZNL-CRAIPNDOSA-N |
| XLogP | 2.79 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |