C15H14O2 — CID 139089631
hydron;(4R)-4-phenyl-4,6,7,8-tetrahydrochromen-5-one (PubChem CID 139089631) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is hydron;(4R)-4-phenyl-4,6,7,8-tetrahydrochromen-5-one.
| Compound Name | hydron;(4R)-4-phenyl-4,6,7,8-tetrahydrochromen-5-one |
|---|---|
| PubChem CID | 139089631 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | hydron;(4R)-4-phenyl-4,6,7,8-tetrahydrochromen-5-one |
| SMILES | O=C1CCCC2=C1[C@@H](c1cc[c-]cc1)C=CO2.[H+] |
| InChI | InChI=1S/C15H13O2/c16-13-7-4-8-14-15(13)12(9-10-17-14)11-5-2-1-3-6-11/h2-3,5-6,9-10,12H,4,7-8H2/q-1/p+1/t12-/m1/s1 |
| InChIKey | LRTXEASHHFBLCJ-GFCCVEGCSA-O |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|