C20H21NO4 — CID 139089894
(3S,5R,6R)-1'-benzyl-5,6-dihydroxyspiro[cyclohexene-3,3'-indole]-2'-one;hydrate (PubChem CID 139089894) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (3S,5R,6R)-1'-benzyl-5,6-dihydroxyspiro[cyclohexene-3,3'-indole]-2'-one;hydrate.
| Compound Name | (3S,5R,6R)-1'-benzyl-5,6-dihydroxyspiro[cyclohexene-3,3'-indole]-2'-one;hydrate |
|---|---|
| PubChem CID | 139089894 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (3S,5R,6R)-1'-benzyl-5,6-dihydroxyspiro[cyclohexene-3,3'-indole]-2'-one;hydrate |
| SMILES | O.O=C1N(Cc2ccccc2)c2ccccc2[C@]12C=C[C@@H](O)[C@H](O)C2 |
| InChI | InChI=1S/C20H19NO3.H2O/c22-17-10-11-20(12-18(17)23)15-8-4-5-9-16(15)21(19(20)24)13-14-6-2-1-3-7-14;/h1-11,17-18,22-23H,12-13H2;1H2/t17-,18-,20-;/m1./s1 |
| InChIKey | RPARIPOVPFOCDD-YPXVDWTCSA-N |
| XLogP | 1.33 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|