C70H64O10 — CID 139090295
5-[3-(methoxymethoxy)-4-[2-(methoxymethoxy)naphthalen-1-yl]naphthalen-2-yl]-2,2-dimethyl-3H-inden-1-one (PubChem CID 139090295) has the molecular formula C70H64O10 and a molecular weight of 1065.27 g/mol. Its IUPAC name is 5-[3-(methoxymethoxy)-4-[2-(methoxymethoxy)naphthalen-1-yl]naphthalen-2-yl]-2,2-dimethyl-3H-inden-1-one.
| Compound Name | 5-[3-(methoxymethoxy)-4-[2-(methoxymethoxy)naphthalen-1-yl]naphthalen-2-yl]-2,2-dimethyl-3H-inden-1-one |
|---|---|
| PubChem CID | 139090295 |
| Molecular Formula | C70H64O10 |
| Molecular Weight | 1065.27 g/mol |
| Exact Mass | 1064.45 |
| IUPAC Name | 5-[3-(methoxymethoxy)-4-[2-(methoxymethoxy)naphthalen-1-yl]naphthalen-2-yl]-2,2-dimethyl-3H-inden-1-one |
| SMILES | COCOc1ccc2ccccc2c1-c1c(OCOC)c(-c2ccc3c(c2)CC(C)(C)C3=O)cc2ccccc12.COCOc1ccc2ccccc2c1-c1c(OCOC)c(-c2ccc3c(c2)CC(C)(C)C3=O)cc2ccccc12 |
| InChI | InChI=1S/2C35H32O5/c2*1-35(2)19-25-17-24(13-15-28(25)34(35)36)29-18-23-10-6-8-12-27(23)32(33(29)40-21-38-4)31-26-11-7-5-9-22(26)14-16-30(31)39-20-37-3/h2*5-18H,19-21H2,1-4H3 |
| InChIKey | ZMMHNUYDWQKWCI-UHFFFAOYSA-N |
| XLogP | 16.11 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.27 |
| LogP ≤ 5 | 16.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|